About 2-ethylpyridine;1-fluoro-2-methylbenzene
2-ethylpyridine;1-fluoro-2-methylbenzene (PubChem CID 142160976) has the molecular formula C14H16FN
and a molecular weight of 217.29 g/mol. Its IUPAC name is 2-ethylpyridine;1-fluoro-2-methylbenzene.
Molecular Properties
| Compound Name | 2-ethylpyridine;1-fluoro-2-methylbenzene |
| PubChem CID | 142160976 |
| Molecular Formula | C14H16FN |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 2-ethylpyridine;1-fluoro-2-methylbenzene |
| SMILES | CCc1ccccn1.Cc1ccccc1F |
| InChI | InChI=1S/C7H7F.C7H9N/c1-6-4-2-3-5-7(6)8;1-2-7-5-3-4-6-8-7/h2-5H,1H3;3-6H,2H2,1H3 |
| InChIKey | HEWPWVROQGDJBH-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethylpyridine;1-fluoro-2-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylpyridine;1-fluoro-2-methylbenzene?
The IUPAC name of 2-ethylpyridine;1-fluoro-2-methylbenzene (CID 142160976) is 2-ethylpyridine;1-fluoro-2-methylbenzene.
What is the SMILES notation for 2-ethylpyridine;1-fluoro-2-methylbenzene?
The canonical SMILES for 2-ethylpyridine;1-fluoro-2-methylbenzene is CCc1ccccn1.Cc1ccccc1F.
What is the InChIKey of 2-ethylpyridine;1-fluoro-2-methylbenzene?
The InChIKey is HEWPWVROQGDJBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F.C7H9N/c1-6-4-2-3-5-7(6)8;1-2-7-5-3-4-6-8-7/h2-5H,1H3;3-6H,2H2,1H3.
What are the key properties of 2-ethylpyridine;1-fluoro-2-methylbenzene?
2-ethylpyridine;1-fluoro-2-methylbenzene has a molecular weight of 217.29 g/mol, XLogP of 3.78, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylpyridine;1-fluoro-2-methylbenzene is sourced from PubChem (CID 142160976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).