About 2-ethylpyridine;sulfurous acid
2-ethylpyridine;sulfurous acid (PubChem CID 174743952) has the molecular formula C7H13NO6S2
and a molecular weight of 271.32 g/mol. Its IUPAC name is 2-ethylpyridine;sulfurous acid.
Molecular Properties
| Compound Name | 2-ethylpyridine;sulfurous acid |
| PubChem CID | 174743952 |
| Molecular Formula | C7H13NO6S2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 2-ethylpyridine;sulfurous acid |
| SMILES | CCc1ccccn1.O=S(O)O.O=S(O)O |
| InChI | InChI=1S/C7H9N.2H2O3S/c1-2-7-5-3-4-6-8-7;2*1-4(2)3/h3-6H,2H2,1H3;2*(H2,1,2,3) |
| InChIKey | KMCMQBXPKJTZBK-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylpyridine;sulfurous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylpyridine;sulfurous acid?
The IUPAC name of 2-ethylpyridine;sulfurous acid (CID 174743952) is 2-ethylpyridine;sulfurous acid.
What is the SMILES notation for 2-ethylpyridine;sulfurous acid?
The canonical SMILES for 2-ethylpyridine;sulfurous acid is CCc1ccccn1.O=S(O)O.O=S(O)O.
What is the InChIKey of 2-ethylpyridine;sulfurous acid?
The InChIKey is KMCMQBXPKJTZBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N.2H2O3S/c1-2-7-5-3-4-6-8-7;2*1-4(2)3/h3-6H,2H2,1H3;2*(H2,1,2,3).
What are the key properties of 2-ethylpyridine;sulfurous acid?
2-ethylpyridine;sulfurous acid has a molecular weight of 271.32 g/mol, XLogP of 1.01, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylpyridine;sulfurous acid is sourced from PubChem (CID 174743952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).