About 2-pyridin-2-ylethyl hydrogen sulfite
2-pyridin-2-ylethyl hydrogen sulfite (PubChem CID 57284965) has the molecular formula C7H9NO3S
and a molecular weight of 187.22 g/mol. Its IUPAC name is 2-pyridin-2-ylethyl hydrogen sulfite.
Molecular Properties
| Compound Name | 2-pyridin-2-ylethyl hydrogen sulfite |
| PubChem CID | 57284965 |
| Molecular Formula | C7H9NO3S |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.03 |
| IUPAC Name | 2-pyridin-2-ylethyl hydrogen sulfite |
| SMILES | O=S(O)OCCc1ccccn1 |
| InChI | InChI=1S/C7H9NO3S/c9-12(10)11-6-4-7-3-1-2-5-8-7/h1-3,5H,4,6H2,(H,9,10) |
| InChIKey | FCZUMEGLCSOSGS-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-pyridin-2-ylethyl hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-2-ylethyl hydrogen sulfite?
The IUPAC name of 2-pyridin-2-ylethyl hydrogen sulfite (CID 57284965) is 2-pyridin-2-ylethyl hydrogen sulfite.
What is the SMILES notation for 2-pyridin-2-ylethyl hydrogen sulfite?
The canonical SMILES for 2-pyridin-2-ylethyl hydrogen sulfite is O=S(O)OCCc1ccccn1.
What is the InChIKey of 2-pyridin-2-ylethyl hydrogen sulfite?
The InChIKey is FCZUMEGLCSOSGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3S/c9-12(10)11-6-4-7-3-1-2-5-8-7/h1-3,5H,4,6H2,(H,9,10).
What are the key properties of 2-pyridin-2-ylethyl hydrogen sulfite?
2-pyridin-2-ylethyl hydrogen sulfite has a molecular weight of 187.22 g/mol, XLogP of 0.78, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-ylethyl hydrogen sulfite is sourced from PubChem (CID 57284965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).