About 2-pyridin-2-ylethyl 2-sulfanylacetate
2-pyridin-2-ylethyl 2-sulfanylacetate (PubChem CID 71772265) has the molecular formula C9H11NO2S
and a molecular weight of 197.26 g/mol. Its IUPAC name is 2-pyridin-2-ylethyl 2-sulfanylacetate.
Molecular Properties
| Compound Name | 2-pyridin-2-ylethyl 2-sulfanylacetate |
| PubChem CID | 71772265 |
| Molecular Formula | C9H11NO2S |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.05 |
| IUPAC Name | 2-pyridin-2-ylethyl 2-sulfanylacetate |
| SMILES | O=C(CS)OCCc1ccccn1 |
| InChI | InChI=1S/C9H11NO2S/c11-9(7-13)12-6-4-8-3-1-2-5-10-8/h1-3,5,13H,4,6-7H2 |
| InChIKey | FFOCWCREIRHAQV-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 39.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-pyridin-2-ylethyl 2-sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-2-ylethyl 2-sulfanylacetate?
The IUPAC name of 2-pyridin-2-ylethyl 2-sulfanylacetate (CID 71772265) is 2-pyridin-2-ylethyl 2-sulfanylacetate.
What is the SMILES notation for 2-pyridin-2-ylethyl 2-sulfanylacetate?
The canonical SMILES for 2-pyridin-2-ylethyl 2-sulfanylacetate is O=C(CS)OCCc1ccccn1.
What is the InChIKey of 2-pyridin-2-ylethyl 2-sulfanylacetate?
The InChIKey is FFOCWCREIRHAQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2S/c11-9(7-13)12-6-4-8-3-1-2-5-10-8/h1-3,5,13H,4,6-7H2.
What are the key properties of 2-pyridin-2-ylethyl 2-sulfanylacetate?
2-pyridin-2-ylethyl 2-sulfanylacetate has a molecular weight of 197.26 g/mol, XLogP of 1.10, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-ylethyl 2-sulfanylacetate is sourced from PubChem (CID 71772265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).