About 2-pyridin-2-ylethyl pyrimidine-5-carboxylate
2-pyridin-2-ylethyl pyrimidine-5-carboxylate (PubChem CID 141091460) has the molecular formula C12H11N3O2
and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-pyridin-2-ylethyl pyrimidine-5-carboxylate.
Molecular Properties
| Compound Name | 2-pyridin-2-ylethyl pyrimidine-5-carboxylate |
| PubChem CID | 141091460 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-pyridin-2-ylethyl pyrimidine-5-carboxylate |
| SMILES | O=C(OCCc1ccccn1)c1cncnc1 |
| InChI | InChI=1S/C12H11N3O2/c16-12(10-7-13-9-14-8-10)17-6-4-11-3-1-2-5-15-11/h1-3,5,7-9H,4,6H2 |
| InChIKey | HDUOZQOZIRPLQP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-pyridin-2-ylethyl pyrimidine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-2-ylethyl pyrimidine-5-carboxylate?
The IUPAC name of 2-pyridin-2-ylethyl pyrimidine-5-carboxylate (CID 141091460) is 2-pyridin-2-ylethyl pyrimidine-5-carboxylate.
What is the SMILES notation for 2-pyridin-2-ylethyl pyrimidine-5-carboxylate?
The canonical SMILES for 2-pyridin-2-ylethyl pyrimidine-5-carboxylate is O=C(OCCc1ccccn1)c1cncnc1.
What is the InChIKey of 2-pyridin-2-ylethyl pyrimidine-5-carboxylate?
The InChIKey is HDUOZQOZIRPLQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O2/c16-12(10-7-13-9-14-8-10)17-6-4-11-3-1-2-5-15-11/h1-3,5,7-9H,4,6H2.
What are the key properties of 2-pyridin-2-ylethyl pyrimidine-5-carboxylate?
2-pyridin-2-ylethyl pyrimidine-5-carboxylate has a molecular weight of 229.24 g/mol, XLogP of 1.27, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-ylethyl pyrimidine-5-carboxylate is sourced from PubChem (CID 141091460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).