About 2-pyridin-2-ylethyl 3-(2-aminophenoxy)propanoate
2-pyridin-2-ylethyl 3-(2-aminophenoxy)propanoate (PubChem CID 61314652) has the molecular formula C16H18N2O3
and a molecular weight of 286.33 g/mol. Its IUPAC name is 2-pyridin-2-ylethyl 3-(2-aminophenoxy)propanoate.
Molecular Properties
| Compound Name | 2-pyridin-2-ylethyl 3-(2-aminophenoxy)propanoate |
| PubChem CID | 61314652 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 2-pyridin-2-ylethyl 3-(2-aminophenoxy)propanoate |
| SMILES | Nc1ccccc1OCCC(=O)OCCc1ccccn1 |
| InChI | InChI=1S/C16H18N2O3/c17-14-6-1-2-7-15(14)20-12-9-16(19)21-11-8-13-5-3-4-10-18-13/h1-7,10H,8-9,11-12,17H2 |
| InChIKey | BIMYICWZJQODSE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-pyridin-2-ylethyl 3-(2-aminophenoxy)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-2-ylethyl 3-(2-aminophenoxy)propanoate?
The IUPAC name of 2-pyridin-2-ylethyl 3-(2-aminophenoxy)propanoate (CID 61314652) is 2-pyridin-2-ylethyl 3-(2-aminophenoxy)propanoate.
What is the SMILES notation for 2-pyridin-2-ylethyl 3-(2-aminophenoxy)propanoate?
The canonical SMILES for 2-pyridin-2-ylethyl 3-(2-aminophenoxy)propanoate is Nc1ccccc1OCCC(=O)OCCc1ccccn1.
What is the InChIKey of 2-pyridin-2-ylethyl 3-(2-aminophenoxy)propanoate?
The InChIKey is BIMYICWZJQODSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O3/c17-14-6-1-2-7-15(14)20-12-9-16(19)21-11-8-13-5-3-4-10-18-13/h1-7,10H,8-9,11-12,17H2.
What are the key properties of 2-pyridin-2-ylethyl 3-(2-aminophenoxy)propanoate?
2-pyridin-2-ylethyl 3-(2-aminophenoxy)propanoate has a molecular weight of 286.33 g/mol, XLogP of 2.22, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-ylethyl 3-(2-aminophenoxy)propanoate is sourced from PubChem (CID 61314652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).