C16H11NO5 — CID 147912935
2-pyridin-2-ylethyl 1,3-dioxo-2-benzofuran-5-carboxylate (PubChem CID 147912935) has the molecular formula C16H11NO5 and a molecular weight of 297.27 g/mol. Its IUPAC name is 2-pyridin-2-ylethyl 1,3-dioxo-2-benzofuran-5-carboxylate.
| Compound Name | 2-pyridin-2-ylethyl 1,3-dioxo-2-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 147912935 |
| Molecular Formula | C16H11NO5 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 2-pyridin-2-ylethyl 1,3-dioxo-2-benzofuran-5-carboxylate |
| SMILES | O=C(OCCc1ccccn1)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C16H11NO5/c18-14(21-8-6-11-3-1-2-7-17-11)10-4-5-12-13(9-10)16(20)22-15(12)19/h1-5,7,9H,6,8H2 |
| InChIKey | IGMNPWSULUCSHO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|