C23H14O12 — CID 22949761
[3-acetyloxy-2-(1,3-dioxo-2-benzofuran-5-carbonyl)oxypropyl] 1,3-dioxo-2-benzofuran-5-carboxylate (PubChem CID 22949761) has the molecular formula C23H14O12 and a molecular weight of 482.35 g/mol. Its IUPAC name is [3-acetyloxy-2-(1,3-dioxo-2-benzofuran-5-carbonyl)oxypropyl] 1,3-dioxo-2-benzofuran-5-carboxylate.
| Compound Name | [3-acetyloxy-2-(1,3-dioxo-2-benzofuran-5-carbonyl)oxypropyl] 1,3-dioxo-2-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 22949761 |
| Molecular Formula | C23H14O12 |
| Molecular Weight | 482.35 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | [3-acetyloxy-2-(1,3-dioxo-2-benzofuran-5-carbonyl)oxypropyl] 1,3-dioxo-2-benzofuran-5-carboxylate |
| SMILES | CC(=O)OCC(COC(=O)c1ccc2c(c1)C(=O)OC2=O)OC(=O)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C23H14O12/c1-10(24)31-8-13(33-19(26)12-3-5-15-17(7-12)23(30)35-21(15)28)9-32-18(25)11-2-4-14-16(6-11)22(29)34-20(14)27/h2-7,13H,8-9H2,1H3 |
| InChIKey | LZEUXOQVVIGXTN-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 165.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|