C26H18O14S — CID 153445040
2-[3,4-bis[(1,3-dioxo-2-benzofuran-5-carbonyl)oxy]butylsulfanyl]butanedioic acid (PubChem CID 153445040) has the molecular formula C26H18O14S and a molecular weight of 586.48 g/mol. Its IUPAC name is 2-[3,4-bis[(1,3-dioxo-2-benzofuran-5-carbonyl)oxy]butylsulfanyl]butanedioic acid.
| Compound Name | 2-[3,4-bis[(1,3-dioxo-2-benzofuran-5-carbonyl)oxy]butylsulfanyl]butanedioic acid |
|---|---|
| PubChem CID | 153445040 |
| Molecular Formula | C26H18O14S |
| Molecular Weight | 586.48 g/mol |
| Exact Mass | 586.04 |
| IUPAC Name | 2-[3,4-bis[(1,3-dioxo-2-benzofuran-5-carbonyl)oxy]butylsulfanyl]butanedioic acid |
| SMILES | O=C(O)CC(SCCC(COC(=O)c1ccc2c(c1)C(=O)OC2=O)OC(=O)c1ccc2c(c1)C(=O)OC2=O)C(=O)O |
| InChI | InChI=1S/C26H18O14S/c27-19(28)9-18(20(29)30)41-6-5-13(38-22(32)12-2-4-15-17(8-12)26(36)40-24(15)34)10-37-21(31)11-1-3-14-16(7-11)25(35)39-23(14)33/h1-4,7-8,13,18H,5-6,9-10H2,(H,27,28)(H,29,30) |
| InChIKey | DSLBTUOKJOCUMB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 213.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.48 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|