C12H12O5 — CID 88813188
1,3-dioxo-2-benzofuran-5-carboxylic acid;propane (PubChem CID 88813188) has the molecular formula C12H12O5 and a molecular weight of 236.22 g/mol. Its IUPAC name is 1,3-dioxo-2-benzofuran-5-carboxylic acid;propane.
| Compound Name | 1,3-dioxo-2-benzofuran-5-carboxylic acid;propane |
|---|---|
| PubChem CID | 88813188 |
| Molecular Formula | C12H12O5 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 1,3-dioxo-2-benzofuran-5-carboxylic acid;propane |
| SMILES | CCC.O=C(O)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C9H4O5.C3H8/c10-7(11)4-1-2-5-6(3-4)9(13)14-8(5)12;1-3-2/h1-3H,(H,10,11);3H2,1-2H3 |
| InChIKey | YTPVHMYQHBMDQF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|