C13H14O7 — CID 175439389
butane-1,1-diol;1,3-dioxo-2-benzofuran-5-carboxylic acid (PubChem CID 175439389) has the molecular formula C13H14O7 and a molecular weight of 282.25 g/mol. Its IUPAC name is butane-1,1-diol;1,3-dioxo-2-benzofuran-5-carboxylic acid.
| Compound Name | butane-1,1-diol;1,3-dioxo-2-benzofuran-5-carboxylic acid |
|---|---|
| PubChem CID | 175439389 |
| Molecular Formula | C13H14O7 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | butane-1,1-diol;1,3-dioxo-2-benzofuran-5-carboxylic acid |
| SMILES | CCCC(O)O.O=C(O)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C9H4O5.C4H10O2/c10-7(11)4-1-2-5-6(3-4)9(13)14-8(5)12;1-2-3-4(5)6/h1-3H,(H,10,11);4-6H,2-3H2,1H3 |
| InChIKey | YRWQVPIKARCSOQ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|