butane-1,1-diol;1,3-dioxo-2-benzofuran-5-carboxylic acid

C13H14O7 — CID 175439389

IUPACbutane-1,1-diol;1,3-dioxo-2-benzofuran-5-carboxylic acid
SMILESCCCC(O)O.O=C(O)c1ccc2c(c1)C(=O)OC2=O
InChIInChI=1S/C9H4O5.C4H10O2/c10-7(11)4-1-2-5-6(3-4)9(13)14-8(5)12;1-2-3-4(5)6/h1-3H,(H,10,11);4-6H,2-3H2,1H3
InChIKeyYRWQVPIKARCSOQ-UHFFFAOYSA-N
MW282.25 g/mol
LogP0.79
Rot. Bonds3

About butane-1,1-diol;1,3-dioxo-2-benzofuran-5-carboxylic acid

butane-1,1-diol;1,3-dioxo-2-benzofuran-5-carboxylic acid (PubChem CID 175439389) has the molecular formula C13H14O7 and a molecular weight of 282.25 g/mol. Its IUPAC name is butane-1,1-diol;1,3-dioxo-2-benzofuran-5-carboxylic acid.

Molecular Properties

Compound Namebutane-1,1-diol;1,3-dioxo-2-benzofuran-5-carboxylic acid
PubChem CID175439389
Molecular FormulaC13H14O7
Molecular Weight282.25 g/mol
Exact Mass282.07
IUPAC Namebutane-1,1-diol;1,3-dioxo-2-benzofuran-5-carboxylic acid
SMILESCCCC(O)O.O=C(O)c1ccc2c(c1)C(=O)OC2=O
InChIInChI=1S/C9H4O5.C4H10O2/c10-7(11)4-1-2-5-6(3-4)9(13)14-8(5)12;1-2-3-4(5)6/h1-3H,(H,10,11);4-6H,2-3H2,1H3
InChIKeyYRWQVPIKARCSOQ-UHFFFAOYSA-N
XLogP0.79
TPSA121.13 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.25
LogP ≤ 50.79
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze butane-1,1-diol;1,3-dioxo-2-benzofuran-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of butane-1,1-diol;1,3-dioxo-2-benzofuran-5-carboxylic acid?
The IUPAC name of butane-1,1-diol;1,3-dioxo-2-benzofuran-5-carboxylic acid (CID 175439389) is butane-1,1-diol;1,3-dioxo-2-benzofuran-5-carboxylic acid.
What is the SMILES notation for butane-1,1-diol;1,3-dioxo-2-benzofuran-5-carboxylic acid?
The canonical SMILES for butane-1,1-diol;1,3-dioxo-2-benzofuran-5-carboxylic acid is CCCC(O)O.O=C(O)c1ccc2c(c1)C(=O)OC2=O.
What is the InChIKey of butane-1,1-diol;1,3-dioxo-2-benzofuran-5-carboxylic acid?
The InChIKey is YRWQVPIKARCSOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4O5.C4H10O2/c10-7(11)4-1-2-5-6(3-4)9(13)14-8(5)12;1-2-3-4(5)6/h1-3H,(H,10,11);4-6H,2-3H2,1H3.
What are the key properties of butane-1,1-diol;1,3-dioxo-2-benzofuran-5-carboxylic acid?
butane-1,1-diol;1,3-dioxo-2-benzofuran-5-carboxylic acid has a molecular weight of 282.25 g/mol, XLogP of 0.79, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for butane-1,1-diol;1,3-dioxo-2-benzofuran-5-carboxylic acid is sourced from PubChem (CID 175439389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).