C17H14O5Si — CID 20584029
4-[(1,3-dioxo-2-benzofuran-5-yl)-dimethylsilyl]benzoic acid (PubChem CID 20584029) has the molecular formula C17H14O5Si and a molecular weight of 326.38 g/mol. Its IUPAC name is 4-[(1,3-dioxo-2-benzofuran-5-yl)-dimethylsilyl]benzoic acid.
| Compound Name | 4-[(1,3-dioxo-2-benzofuran-5-yl)-dimethylsilyl]benzoic acid |
|---|---|
| PubChem CID | 20584029 |
| Molecular Formula | C17H14O5Si |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | 4-[(1,3-dioxo-2-benzofuran-5-yl)-dimethylsilyl]benzoic acid |
| SMILES | C[Si](C)(c1ccc(C(=O)O)cc1)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C17H14O5Si/c1-23(2,11-5-3-10(4-6-11)15(18)19)12-7-8-13-14(9-12)17(21)22-16(13)20/h3-9H,1-2H3,(H,18,19) |
| InChIKey | HACJCJDIUQEKJZ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|