C30H19F3O7 — CID 90141113
4-[4-[2-[4-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenyl]-1,1,1-trifluoropropan-2-yl]phenoxy]benzoic acid (PubChem CID 90141113) has the molecular formula C30H19F3O7 and a molecular weight of 548.47 g/mol. Its IUPAC name is 4-[4-[2-[4-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenyl]-1,1,1-trifluoropropan-2-yl]phenoxy]benzoic acid.
| Compound Name | 4-[4-[2-[4-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenyl]-1,1,1-trifluoropropan-2-yl]phenoxy]benzoic acid |
|---|---|
| PubChem CID | 90141113 |
| Molecular Formula | C30H19F3O7 |
| Molecular Weight | 548.47 g/mol |
| Exact Mass | 548.11 |
| IUPAC Name | 4-[4-[2-[4-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenyl]-1,1,1-trifluoropropan-2-yl]phenoxy]benzoic acid |
| SMILES | CC(c1ccc(Oc2ccc(C(=O)O)cc2)cc1)(c1ccc(Oc2ccc3c(c2)C(=O)OC3=O)cc1)C(F)(F)F |
| InChI | InChI=1S/C30H19F3O7/c1-29(30(31,32)33,18-4-10-21(11-5-18)38-20-8-2-17(3-9-20)26(34)35)19-6-12-22(13-7-19)39-23-14-15-24-25(16-23)28(37)40-27(24)36/h2-16H,1H3,(H,34,35) |
| InChIKey | YAXDXAZSEQMERZ-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.47 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|