C19H11F3O6 — CID 163488351
5-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1-trifluoropropan-2-yl]-2-formylbenzoic acid (PubChem CID 163488351) has the molecular formula C19H11F3O6 and a molecular weight of 392.29 g/mol. Its IUPAC name is 5-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1-trifluoropropan-2-yl]-2-formylbenzoic acid.
| Compound Name | 5-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1-trifluoropropan-2-yl]-2-formylbenzoic acid |
|---|---|
| PubChem CID | 163488351 |
| Molecular Formula | C19H11F3O6 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | 5-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1-trifluoropropan-2-yl]-2-formylbenzoic acid |
| SMILES | CC(c1ccc(C=O)c(C(=O)O)c1)(c1ccc2c(c1)C(=O)OC2=O)C(F)(F)F |
| InChI | InChI=1S/C19H11F3O6/c1-18(19(20,21)22,10-3-2-9(8-23)13(6-10)15(24)25)11-4-5-12-14(7-11)17(27)28-16(12)26/h2-8H,1H3,(H,24,25) |
| InChIKey | CKLZYKQQRHMXJS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|