C34H14F12O6 — CID 44717331
5-[2-[4-[4-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-benzofuran-1,3-dione (PubChem CID 44717331) has the molecular formula C34H14F12O6 and a molecular weight of 746.46 g/mol. Its IUPAC name is 5-[2-[4-[4-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-benzofuran-1,3-dione.
| Compound Name | 5-[2-[4-[4-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 44717331 |
| Molecular Formula | C34H14F12O6 |
| Molecular Weight | 746.46 g/mol |
| Exact Mass | 746.06 |
| IUPAC Name | 5-[2-[4-[4-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]phenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2cc(C(c3ccc(-c4ccc(C(c5ccc6c(c5)C(=O)OC6=O)(C(F)(F)F)C(F)(F)F)cc4)cc3)(C(F)(F)F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C34H14F12O6/c35-31(36,37)29(32(38,39)40,19-9-11-21-23(13-19)27(49)51-25(21)47)17-5-1-15(2-6-17)16-3-7-18(8-4-16)30(33(41,42)43,34(44,45)46)20-10-12-22-24(14-20)28(50)52-26(22)48/h1-14H |
| InChIKey | PHNGPTTVBYKWRD-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.46 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|