C15H7F3O3 — CID 89288630
5-[4-(trifluoromethyl)phenyl]-2-benzofuran-1,3-dione (PubChem CID 89288630) has the molecular formula C15H7F3O3 and a molecular weight of 292.21 g/mol. Its IUPAC name is 5-[4-(trifluoromethyl)phenyl]-2-benzofuran-1,3-dione.
| Compound Name | 5-[4-(trifluoromethyl)phenyl]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 89288630 |
| Molecular Formula | C15H7F3O3 |
| Molecular Weight | 292.21 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 5-[4-(trifluoromethyl)phenyl]-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2cc(-c3ccc(C(F)(F)F)cc3)ccc21 |
| InChI | InChI=1S/C15H7F3O3/c16-15(17,18)10-4-1-8(2-5-10)9-3-6-11-12(7-9)14(20)21-13(11)19/h1-7H |
| InChIKey | OSUGOWPYWSEDIU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.21 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|