C14H6O6 — CID 143137573
10-formyl-2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaene-8-carboxylic acid (PubChem CID 143137573) has the molecular formula C14H6O6 and a molecular weight of 270.20 g/mol. Its IUPAC name is 10-formyl-2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaene-8-carboxylic acid.
| Compound Name | 10-formyl-2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaene-8-carboxylic acid |
|---|---|
| PubChem CID | 143137573 |
| Molecular Formula | C14H6O6 |
| Molecular Weight | 270.20 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 10-formyl-2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(13),5,7,9,11-pentaene-8-carboxylic acid |
| SMILES | O=Cc1ccc2c3c(ccc(C(=O)O)c13)C(=O)OC2=O |
| InChI | InChI=1S/C14H6O6/c15-5-6-1-2-8-11-9(14(19)20-13(8)18)4-3-7(10(6)11)12(16)17/h1-5H,(H,16,17) |
| InChIKey | VOKQSVCEUQJUER-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.20 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|