C16H10O5 — CID 170484537
4-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-yl)but-3-enoic acid (PubChem CID 170484537) has the molecular formula C16H10O5 and a molecular weight of 282.25 g/mol. Its IUPAC name is 4-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-yl)but-3-enoic acid.
| Compound Name | 4-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-yl)but-3-enoic acid |
|---|---|
| PubChem CID | 170484537 |
| Molecular Formula | C16H10O5 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 4-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-yl)but-3-enoic acid |
| SMILES | O=C(O)CC=Cc1ccc2c3c(cccc13)C(=O)OC2=O |
| InChI | InChI=1S/C16H10O5/c17-13(18)6-1-3-9-7-8-12-14-10(9)4-2-5-11(14)15(19)21-16(12)20/h1-5,7-8H,6H2,(H,17,18) |
| InChIKey | LKDRONDERYFBKT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|