C20H12O3 — CID 126641639
8-[(E)-2-phenylethenyl]-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione (PubChem CID 126641639) has the molecular formula C20H12O3 and a molecular weight of 300.31 g/mol. Its IUPAC name is 8-[(E)-2-phenylethenyl]-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione.
| Compound Name | 8-[(E)-2-phenylethenyl]-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
|---|---|
| PubChem CID | 126641639 |
| Molecular Formula | C20H12O3 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 8-[(E)-2-phenylethenyl]-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
| SMILES | O=C1OC(=O)c2ccc(/C=C/c3ccccc3)c3cccc1c23 |
| InChI | InChI=1S/C20H12O3/c21-19-16-8-4-7-15-14(10-9-13-5-2-1-3-6-13)11-12-17(18(15)16)20(22)23-19/h1-12H/b10-9+ |
| InChIKey | YJSQICKZJFTEPE-MDZDMXLPSA-N |
| XLogP | 4.32 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|