C26H16O6Si — CID 14122170
8-[(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-yl)-dimethylsilyl]-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione (PubChem CID 14122170) has the molecular formula C26H16O6Si and a molecular weight of 452.49 g/mol. Its IUPAC name is 8-[(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-yl)-dimethylsilyl]-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione.
| Compound Name | 8-[(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-yl)-dimethylsilyl]-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
|---|---|
| PubChem CID | 14122170 |
| Molecular Formula | C26H16O6Si |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | 8-[(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-yl)-dimethylsilyl]-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
| SMILES | C[Si](C)(c1ccc2c3c(cccc13)C(=O)OC2=O)c1ccc2c3c(cccc13)C(=O)OC2=O |
| InChI | InChI=1S/C26H16O6Si/c1-33(2,19-11-9-17-21-13(19)5-3-7-15(21)23(27)31-25(17)29)20-12-10-18-22-14(20)6-4-8-16(22)24(28)32-26(18)30/h3-12H,1-2H3 |
| InChIKey | XCGOVPXHPKIEBE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|