C12H8KO6S — CID 176507808
CID 176507808 (PubChem CID 176507808) has the molecular formula C12H8KO6S and a molecular weight of 319.35 g/mol.
| Compound Name | CID 176507808 |
|---|---|
| PubChem CID | 176507808 |
| Molecular Formula | C12H8KO6S |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 318.97 |
| IUPAC Name | — |
| SMILES | O=C1OC(=O)c2ccc(S(=O)(=O)O)c3cccc1c23.[H][H].[K] |
| InChI | InChI=1S/C12H6O6S.K.H2/c13-11-7-3-1-2-6-9(19(15,16)17)5-4-8(10(6)7)12(14)18-11;;/h1-5H,(H,15,16,17);;1H |
| InChIKey | CZOOFPCPSKMPJO-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|