C16H15NO6S — CID 14745999
2-(3-methoxypropyl)-1,3-dioxobenzo[de]isoquinoline-6-sulfonic acid (PubChem CID 14745999) has the molecular formula C16H15NO6S and a molecular weight of 349.36 g/mol. Its IUPAC name is 2-(3-methoxypropyl)-1,3-dioxobenzo[de]isoquinoline-6-sulfonic acid.
| Compound Name | 2-(3-methoxypropyl)-1,3-dioxobenzo[de]isoquinoline-6-sulfonic acid |
|---|---|
| PubChem CID | 14745999 |
| Molecular Formula | C16H15NO6S |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | 2-(3-methoxypropyl)-1,3-dioxobenzo[de]isoquinoline-6-sulfonic acid |
| SMILES | COCCCN1C(=O)c2cccc3c(S(=O)(=O)O)ccc(c23)C1=O |
| InChI | InChI=1S/C16H15NO6S/c1-23-9-3-8-17-15(18)11-5-2-4-10-13(24(20,21)22)7-6-12(14(10)11)16(17)19/h2,4-7H,3,8-9H2,1H3,(H,20,21,22) |
| InChIKey | OAGKSDMZCHGXFS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|