C18H20N2O4 — CID 71661976
2-(3-aminopropyl)-6-(2-methoxyethoxy)benzo[de]isoquinoline-1,3-dione (PubChem CID 71661976) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is 2-(3-aminopropyl)-6-(2-methoxyethoxy)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-(3-aminopropyl)-6-(2-methoxyethoxy)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 71661976 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 2-(3-aminopropyl)-6-(2-methoxyethoxy)benzo[de]isoquinoline-1,3-dione |
| SMILES | COCCOc1ccc2c3c(cccc13)C(=O)N(CCCN)C2=O |
| InChI | InChI=1S/C18H20N2O4/c1-23-10-11-24-15-7-6-14-16-12(15)4-2-5-13(16)17(21)20(18(14)22)9-3-8-19/h2,4-7H,3,8-11,19H2,1H3 |
| InChIKey | SYYWDESTHRLKHR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|