C22H18ClN3O5 — CID 9499456
6-(3-chloroanilino)-2-(3-methoxypropyl)-5-nitrobenzo[de]isoquinoline-1,3-dione (PubChem CID 9499456) has the molecular formula C22H18ClN3O5 and a molecular weight of 439.86 g/mol. Its IUPAC name is 6-(3-chloroanilino)-2-(3-methoxypropyl)-5-nitrobenzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-(3-chloroanilino)-2-(3-methoxypropyl)-5-nitrobenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 9499456 |
| Molecular Formula | C22H18ClN3O5 |
| Molecular Weight | 439.86 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | 6-(3-chloroanilino)-2-(3-methoxypropyl)-5-nitrobenzo[de]isoquinoline-1,3-dione |
| SMILES | COCCCN1C(=O)c2cccc3c(Nc4cccc(Cl)c4)c([N+](=O)[O-])cc(c23)C1=O |
| InChI | InChI=1S/C22H18ClN3O5/c1-31-10-4-9-25-21(27)16-8-3-7-15-19(16)17(22(25)28)12-18(26(29)30)20(15)24-14-6-2-5-13(23)11-14/h2-3,5-8,11-12,24H,4,9-10H2,1H3 |
| InChIKey | VNXSGKTYAZXUCA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.86 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|