C21H20Cl2N2O4 — CID 110598868
3-(2,4-dichlorophenyl)-4-(3-methoxyanilino)-1-(3-methoxypropyl)pyrrole-2,5-dione (PubChem CID 110598868) has the molecular formula C21H20Cl2N2O4 and a molecular weight of 435.31 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-4-(3-methoxyanilino)-1-(3-methoxypropyl)pyrrole-2,5-dione.
| Compound Name | 3-(2,4-dichlorophenyl)-4-(3-methoxyanilino)-1-(3-methoxypropyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110598868 |
| Molecular Formula | C21H20Cl2N2O4 |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-4-(3-methoxyanilino)-1-(3-methoxypropyl)pyrrole-2,5-dione |
| SMILES | COCCCN1C(=O)C(Nc2cccc(OC)c2)=C(c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C21H20Cl2N2O4/c1-28-10-4-9-25-20(26)18(16-8-7-13(22)11-17(16)23)19(21(25)27)24-14-5-3-6-15(12-14)29-2/h3,5-8,11-12,24H,4,9-10H2,1-2H3 |
| InChIKey | WUNBBXBVXXUTRB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|