C21H18F4N2O4 — CID 110586349
3-(4-fluorophenyl)-1-(3-methoxypropyl)-4-[3-(trifluoromethoxy)anilino]pyrrole-2,5-dione (PubChem CID 110586349) has the molecular formula C21H18F4N2O4 and a molecular weight of 438.38 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-(3-methoxypropyl)-4-[3-(trifluoromethoxy)anilino]pyrrole-2,5-dione.
| Compound Name | 3-(4-fluorophenyl)-1-(3-methoxypropyl)-4-[3-(trifluoromethoxy)anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110586349 |
| Molecular Formula | C21H18F4N2O4 |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 3-(4-fluorophenyl)-1-(3-methoxypropyl)-4-[3-(trifluoromethoxy)anilino]pyrrole-2,5-dione |
| SMILES | COCCCN1C(=O)C(Nc2cccc(OC(F)(F)F)c2)=C(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C21H18F4N2O4/c1-30-11-3-10-27-19(28)17(13-6-8-14(22)9-7-13)18(20(27)29)26-15-4-2-5-16(12-15)31-21(23,24)25/h2,4-9,12,26H,3,10-11H2,1H3 |
| InChIKey | QIWNSZJZHJEBLM-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|