C22H20F3N3O4 — CID 110596363
N-[4-[2,5-dioxo-1-propyl-4-[3-(trifluoromethoxy)anilino]pyrrol-3-yl]phenyl]acetamide (PubChem CID 110596363) has the molecular formula C22H20F3N3O4 and a molecular weight of 447.41 g/mol. Its IUPAC name is N-[4-[2,5-dioxo-1-propyl-4-[3-(trifluoromethoxy)anilino]pyrrol-3-yl]phenyl]acetamide.
| Compound Name | N-[4-[2,5-dioxo-1-propyl-4-[3-(trifluoromethoxy)anilino]pyrrol-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 110596363 |
| Molecular Formula | C22H20F3N3O4 |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | N-[4-[2,5-dioxo-1-propyl-4-[3-(trifluoromethoxy)anilino]pyrrol-3-yl]phenyl]acetamide |
| SMILES | CCCN1C(=O)C(Nc2cccc(OC(F)(F)F)c2)=C(c2ccc(NC(C)=O)cc2)C1=O |
| InChI | InChI=1S/C22H20F3N3O4/c1-3-11-28-20(30)18(14-7-9-15(10-8-14)26-13(2)29)19(21(28)31)27-16-5-4-6-17(12-16)32-22(23,24)25/h4-10,12,27H,3,11H2,1-2H3,(H,26,29) |
| InChIKey | DCTLMRQDBBQIME-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|