C20H16F3N3O2 — CID 68563416
N-[4-[6-[3-(trifluoromethoxy)anilino]-3-pyridinyl]phenyl]acetamide (PubChem CID 68563416) has the molecular formula C20H16F3N3O2 and a molecular weight of 387.36 g/mol. Its IUPAC name is N-[4-[6-[3-(trifluoromethoxy)anilino]-3-pyridinyl]phenyl]acetamide.
| Compound Name | N-[4-[6-[3-(trifluoromethoxy)anilino]-3-pyridinyl]phenyl]acetamide |
|---|---|
| PubChem CID | 68563416 |
| Molecular Formula | C20H16F3N3O2 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | N-[4-[6-[3-(trifluoromethoxy)anilino]-3-pyridinyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2ccc(Nc3cccc(OC(F)(F)F)c3)nc2)cc1 |
| InChI | InChI=1S/C20H16F3N3O2/c1-13(27)25-16-8-5-14(6-9-16)15-7-10-19(24-12-15)26-17-3-2-4-18(11-17)28-20(21,22)23/h2-12H,1H3,(H,24,26)(H,25,27) |
| InChIKey | JBPCAXKSDFKYOI-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |