C19H15F3N4O2 — CID 142716778
1-[4-(2-amino-4-pyridinyl)phenyl]-3-[3-(trifluoromethoxy)phenyl]urea (PubChem CID 142716778) has the molecular formula C19H15F3N4O2 and a molecular weight of 388.35 g/mol. Its IUPAC name is 1-[4-(2-amino-4-pyridinyl)phenyl]-3-[3-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[4-(2-amino-4-pyridinyl)phenyl]-3-[3-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 142716778 |
| Molecular Formula | C19H15F3N4O2 |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 1-[4-(2-amino-4-pyridinyl)phenyl]-3-[3-(trifluoromethoxy)phenyl]urea |
| SMILES | Nc1cc(-c2ccc(NC(=O)Nc3cccc(OC(F)(F)F)c3)cc2)ccn1 |
| InChI | InChI=1S/C19H15F3N4O2/c20-19(21,22)28-16-3-1-2-15(11-16)26-18(27)25-14-6-4-12(5-7-14)13-8-9-24-17(23)10-13/h1-11H,(H2,23,24)(H2,25,26,27) |
| InChIKey | UJEYQDVFTAQNOZ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |