C16H13F3N5O2S+ — CID 162542090
1-(1-methyl-5-pyridin-4-yl-1,3,4-thiadiazol-1-ium-2-yl)-3-[3-(trifluoromethoxy)phenyl]urea (PubChem CID 162542090) has the molecular formula C16H13F3N5O2S+ and a molecular weight of 396.37 g/mol. Its IUPAC name is 1-(1-methyl-5-pyridin-4-yl-1,3,4-thiadiazol-1-ium-2-yl)-3-[3-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-(1-methyl-5-pyridin-4-yl-1,3,4-thiadiazol-1-ium-2-yl)-3-[3-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 162542090 |
| Molecular Formula | C16H13F3N5O2S+ |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 1-(1-methyl-5-pyridin-4-yl-1,3,4-thiadiazol-1-ium-2-yl)-3-[3-(trifluoromethoxy)phenyl]urea |
| SMILES | C[s+]1c(NC(=O)Nc2cccc(OC(F)(F)F)c2)nnc1-c1ccncc1 |
| InChI | InChI=1S/C16H12F3N5O2S/c1-27-13(10-5-7-20-8-6-10)23-24-15(27)22-14(25)21-11-3-2-4-12(9-11)26-16(17,18)19/h2-9H,1H3,(H-,20,21,22,24,25)/p+1 |
| InChIKey | IQSHCVMKQAWMBG-UHFFFAOYSA-O |
| XLogP | 4.37 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|