C15H12F3NO4 — CID 59014806
2,3-dihydroxy-5-methyl-N-[3-(trifluoromethoxy)phenyl]benzamide (PubChem CID 59014806) has the molecular formula C15H12F3NO4 and a molecular weight of 327.26 g/mol. Its IUPAC name is 2,3-dihydroxy-5-methyl-N-[3-(trifluoromethoxy)phenyl]benzamide.
| Compound Name | 2,3-dihydroxy-5-methyl-N-[3-(trifluoromethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 59014806 |
| Molecular Formula | C15H12F3NO4 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 2,3-dihydroxy-5-methyl-N-[3-(trifluoromethoxy)phenyl]benzamide |
| SMILES | Cc1cc(O)c(O)c(C(=O)Nc2cccc(OC(F)(F)F)c2)c1 |
| InChI | InChI=1S/C15H12F3NO4/c1-8-5-11(13(21)12(20)6-8)14(22)19-9-3-2-4-10(7-9)23-15(16,17)18/h2-7,20-21H,1H3,(H,19,22) |
| InChIKey | IESMEBCJNNPULW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|