C15H12F3NO4 — CID 38204734
2-hydroxy-4-methoxy-N-[3-(trifluoromethoxy)phenyl]benzamide (PubChem CID 38204734) has the molecular formula C15H12F3NO4 and a molecular weight of 327.26 g/mol. Its IUPAC name is 2-hydroxy-4-methoxy-N-[3-(trifluoromethoxy)phenyl]benzamide.
| Compound Name | 2-hydroxy-4-methoxy-N-[3-(trifluoromethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 38204734 |
| Molecular Formula | C15H12F3NO4 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 2-hydroxy-4-methoxy-N-[3-(trifluoromethoxy)phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(OC(F)(F)F)c2)c(O)c1 |
| InChI | InChI=1S/C15H12F3NO4/c1-22-10-5-6-12(13(20)8-10)14(21)19-9-3-2-4-11(7-9)23-15(16,17)18/h2-8,20H,1H3,(H,19,21) |
| InChIKey | AGZDSVXMDMRFPV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |