C11H10ClF3N2O3 — CID 43328961
2-chloro-N-[[3-(trifluoromethoxy)phenyl]carbamoyl]propanamide (PubChem CID 43328961) has the molecular formula C11H10ClF3N2O3 and a molecular weight of 310.66 g/mol. Its IUPAC name is 2-chloro-N-[[3-(trifluoromethoxy)phenyl]carbamoyl]propanamide.
| Compound Name | 2-chloro-N-[[3-(trifluoromethoxy)phenyl]carbamoyl]propanamide |
|---|---|
| PubChem CID | 43328961 |
| Molecular Formula | C11H10ClF3N2O3 |
| Molecular Weight | 310.66 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | 2-chloro-N-[[3-(trifluoromethoxy)phenyl]carbamoyl]propanamide |
| SMILES | CC(Cl)C(=O)NC(=O)Nc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C11H10ClF3N2O3/c1-6(12)9(18)17-10(19)16-7-3-2-4-8(5-7)20-11(13,14)15/h2-6H,1H3,(H2,16,17,18,19) |
| InChIKey | XCQRMQIHCDPXBW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.66 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|