C11H13F3N2O3 — CID 94818397
1-[(2R)-1-hydroxypropan-2-yl]-3-[3-(trifluoromethoxy)phenyl]urea (PubChem CID 94818397) has the molecular formula C11H13F3N2O3 and a molecular weight of 278.23 g/mol. Its IUPAC name is 1-[(2R)-1-hydroxypropan-2-yl]-3-[3-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-[(2R)-1-hydroxypropan-2-yl]-3-[3-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 94818397 |
| Molecular Formula | C11H13F3N2O3 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 1-[(2R)-1-hydroxypropan-2-yl]-3-[3-(trifluoromethoxy)phenyl]urea |
| SMILES | C[C@H](CO)NC(=O)Nc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C11H13F3N2O3/c1-7(6-17)15-10(18)16-8-3-2-4-9(5-8)19-11(12,13)14/h2-5,7,17H,6H2,1H3,(H2,15,16,18)/t7-/m1/s1 |
| InChIKey | UGCUMJFWAMSCAR-SSDOTTSWSA-N |
| XLogP | 2.09 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |