C16H11F3N2O2S — CID 66545932
1-(1-benzothiophen-3-yl)-3-[3-(trifluoromethoxy)phenyl]urea (PubChem CID 66545932) has the molecular formula C16H11F3N2O2S and a molecular weight of 352.34 g/mol. Its IUPAC name is 1-(1-benzothiophen-3-yl)-3-[3-(trifluoromethoxy)phenyl]urea.
| Compound Name | 1-(1-benzothiophen-3-yl)-3-[3-(trifluoromethoxy)phenyl]urea |
|---|---|
| PubChem CID | 66545932 |
| Molecular Formula | C16H11F3N2O2S |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 1-(1-benzothiophen-3-yl)-3-[3-(trifluoromethoxy)phenyl]urea |
| SMILES | O=C(Nc1cccc(OC(F)(F)F)c1)Nc1csc2ccccc12 |
| InChI | InChI=1S/C16H11F3N2O2S/c17-16(18,19)23-11-5-3-4-10(8-11)20-15(22)21-13-9-24-14-7-2-1-6-12(13)14/h1-9H,(H2,20,21,22) |
| InChIKey | MIQDYDUQHOBGDR-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |