C17H12F3N3O3S — CID 142794804
3-[[3-(trifluoromethoxy)phenyl]carbamoylamino]-1-benzothiophene-2-carboxamide (PubChem CID 142794804) has the molecular formula C17H12F3N3O3S and a molecular weight of 395.36 g/mol. Its IUPAC name is 3-[[3-(trifluoromethoxy)phenyl]carbamoylamino]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-[[3-(trifluoromethoxy)phenyl]carbamoylamino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 142794804 |
| Molecular Formula | C17H12F3N3O3S |
| Molecular Weight | 395.36 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 3-[[3-(trifluoromethoxy)phenyl]carbamoylamino]-1-benzothiophene-2-carboxamide |
| SMILES | NC(=O)c1sc2ccccc2c1NC(=O)Nc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C17H12F3N3O3S/c18-17(19,20)26-10-5-3-4-9(8-10)22-16(25)23-13-11-6-1-2-7-12(11)27-14(13)15(21)24/h1-8H,(H2,21,24)(H2,22,23,25) |
| InChIKey | HQLKAOVSVXALGA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.36 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |