C15H11F4N3O3 — CID 156854184
2-[(3-fluorophenyl)carbamoylamino]-4-(trifluoromethoxy)benzamide (PubChem CID 156854184) has the molecular formula C15H11F4N3O3 and a molecular weight of 357.26 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)carbamoylamino]-4-(trifluoromethoxy)benzamide.
| Compound Name | 2-[(3-fluorophenyl)carbamoylamino]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 156854184 |
| Molecular Formula | C15H11F4N3O3 |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 2-[(3-fluorophenyl)carbamoylamino]-4-(trifluoromethoxy)benzamide |
| SMILES | NC(=O)c1ccc(OC(F)(F)F)cc1NC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C15H11F4N3O3/c16-8-2-1-3-9(6-8)21-14(24)22-12-7-10(25-15(17,18)19)4-5-11(12)13(20)23/h1-7H,(H2,20,23)(H2,21,22,24) |
| InChIKey | WSTOSSVARAHBQG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |