C14H11F2N3O2 — CID 156854097
4-fluoro-2-[(3-fluorophenyl)carbamoylamino]benzamide (PubChem CID 156854097) has the molecular formula C14H11F2N3O2 and a molecular weight of 291.26 g/mol. Its IUPAC name is 4-fluoro-2-[(3-fluorophenyl)carbamoylamino]benzamide.
| Compound Name | 4-fluoro-2-[(3-fluorophenyl)carbamoylamino]benzamide |
|---|---|
| PubChem CID | 156854097 |
| Molecular Formula | C14H11F2N3O2 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 4-fluoro-2-[(3-fluorophenyl)carbamoylamino]benzamide |
| SMILES | NC(=O)c1ccc(F)cc1NC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C14H11F2N3O2/c15-8-2-1-3-10(6-8)18-14(21)19-12-7-9(16)4-5-11(12)13(17)20/h1-7H,(H2,17,20)(H2,18,19,21) |
| InChIKey | BPTJYBYYXJVAAW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |