C15H14FN3O3 — CID 156854115
2-[(3-fluorophenyl)carbamoylamino]-4-methoxybenzamide (PubChem CID 156854115) has the molecular formula C15H14FN3O3 and a molecular weight of 303.29 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)carbamoylamino]-4-methoxybenzamide.
| Compound Name | 2-[(3-fluorophenyl)carbamoylamino]-4-methoxybenzamide |
|---|---|
| PubChem CID | 156854115 |
| Molecular Formula | C15H14FN3O3 |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 2-[(3-fluorophenyl)carbamoylamino]-4-methoxybenzamide |
| SMILES | COc1ccc(C(N)=O)c(NC(=O)Nc2cccc(F)c2)c1 |
| InChI | InChI=1S/C15H14FN3O3/c1-22-11-5-6-12(14(17)20)13(8-11)19-15(21)18-10-4-2-3-9(16)7-10/h2-8H,1H3,(H2,17,20)(H2,18,19,21) |
| InChIKey | VPIQMNMOVDOPED-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |