C17H18F2N4O3 — CID 156854286
N-(2-aminoethyl)-2-[(3,5-difluorophenyl)carbamoylamino]-4-methoxybenzamide (PubChem CID 156854286) has the molecular formula C17H18F2N4O3 and a molecular weight of 364.35 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[(3,5-difluorophenyl)carbamoylamino]-4-methoxybenzamide.
| Compound Name | N-(2-aminoethyl)-2-[(3,5-difluorophenyl)carbamoylamino]-4-methoxybenzamide |
|---|---|
| PubChem CID | 156854286 |
| Molecular Formula | C17H18F2N4O3 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | N-(2-aminoethyl)-2-[(3,5-difluorophenyl)carbamoylamino]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCCN)c(NC(=O)Nc2cc(F)cc(F)c2)c1 |
| InChI | InChI=1S/C17H18F2N4O3/c1-26-13-2-3-14(16(24)21-5-4-20)15(9-13)23-17(25)22-12-7-10(18)6-11(19)8-12/h2-3,6-9H,4-5,20H2,1H3,(H,21,24)(H2,22,23,25) |
| InChIKey | PJSQRZZUZHHTTC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |