C17H21FN4O3 — CID 156854477
1-[3-(2-aminoethylamino)-5-methoxyphenyl]-3-[5-fluoro-2-(hydroxymethyl)phenyl]urea (PubChem CID 156854477) has the molecular formula C17H21FN4O3 and a molecular weight of 348.38 g/mol. Its IUPAC name is 1-[3-(2-aminoethylamino)-5-methoxyphenyl]-3-[5-fluoro-2-(hydroxymethyl)phenyl]urea.
| Compound Name | 1-[3-(2-aminoethylamino)-5-methoxyphenyl]-3-[5-fluoro-2-(hydroxymethyl)phenyl]urea |
|---|---|
| PubChem CID | 156854477 |
| Molecular Formula | C17H21FN4O3 |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-[3-(2-aminoethylamino)-5-methoxyphenyl]-3-[5-fluoro-2-(hydroxymethyl)phenyl]urea |
| SMILES | COc1cc(NCCN)cc(NC(=O)Nc2cc(F)ccc2CO)c1 |
| InChI | InChI=1S/C17H21FN4O3/c1-25-15-8-13(20-5-4-19)7-14(9-15)21-17(24)22-16-6-12(18)3-2-11(16)10-23/h2-3,6-9,20,23H,4-5,10,19H2,1H3,(H2,21,22,24) |
| InChIKey | VARRCCGUVCGEDS-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |