C17H20ClN3O4 — CID 156854692
1-[5-chloro-2-(hydroxymethyl)phenyl]-3-[3-(2-hydroxyethylamino)-5-methoxyphenyl]urea (PubChem CID 156854692) has the molecular formula C17H20ClN3O4 and a molecular weight of 365.82 g/mol. Its IUPAC name is 1-[5-chloro-2-(hydroxymethyl)phenyl]-3-[3-(2-hydroxyethylamino)-5-methoxyphenyl]urea.
| Compound Name | 1-[5-chloro-2-(hydroxymethyl)phenyl]-3-[3-(2-hydroxyethylamino)-5-methoxyphenyl]urea |
|---|---|
| PubChem CID | 156854692 |
| Molecular Formula | C17H20ClN3O4 |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 1-[5-chloro-2-(hydroxymethyl)phenyl]-3-[3-(2-hydroxyethylamino)-5-methoxyphenyl]urea |
| SMILES | COc1cc(NCCO)cc(NC(=O)Nc2cc(Cl)ccc2CO)c1 |
| InChI | InChI=1S/C17H20ClN3O4/c1-25-15-8-13(19-4-5-22)7-14(9-15)20-17(24)21-16-6-12(18)3-2-11(16)10-23/h2-3,6-9,19,22-23H,4-5,10H2,1H3,(H2,20,21,24) |
| InChIKey | CTYDMFRHWFYIEN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 102.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |