C16H17BrClN3O3 — CID 166747530
1-[3-bromo-4-[ethyl(hydroxy)amino]phenyl]-3-[5-chloro-2-(hydroxymethyl)phenyl]urea (PubChem CID 166747530) has the molecular formula C16H17BrClN3O3 and a molecular weight of 414.69 g/mol. Its IUPAC name is 1-[3-bromo-4-[ethyl(hydroxy)amino]phenyl]-3-[5-chloro-2-(hydroxymethyl)phenyl]urea.
| Compound Name | 1-[3-bromo-4-[ethyl(hydroxy)amino]phenyl]-3-[5-chloro-2-(hydroxymethyl)phenyl]urea |
|---|---|
| PubChem CID | 166747530 |
| Molecular Formula | C16H17BrClN3O3 |
| Molecular Weight | 414.69 g/mol |
| Exact Mass | 413.01 |
| IUPAC Name | 1-[3-bromo-4-[ethyl(hydroxy)amino]phenyl]-3-[5-chloro-2-(hydroxymethyl)phenyl]urea |
| SMILES | CCN(O)c1ccc(NC(=O)Nc2cc(Cl)ccc2CO)cc1Br |
| InChI | InChI=1S/C16H17BrClN3O3/c1-2-21(24)15-6-5-12(8-13(15)17)19-16(23)20-14-7-11(18)4-3-10(14)9-22/h3-8,22,24H,2,9H2,1H3,(H2,19,20,23) |
| InChIKey | LKQGPAMQVFVQRG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.69 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|