C15H13BrClFN2O2 — CID 166747587
1-(3-bromo-5-fluorophenyl)-3-[5-chloro-2-(2-hydroxyethyl)phenyl]urea (PubChem CID 166747587) has the molecular formula C15H13BrClFN2O2 and a molecular weight of 387.64 g/mol. Its IUPAC name is 1-(3-bromo-5-fluorophenyl)-3-[5-chloro-2-(2-hydroxyethyl)phenyl]urea.
| Compound Name | 1-(3-bromo-5-fluorophenyl)-3-[5-chloro-2-(2-hydroxyethyl)phenyl]urea |
|---|---|
| PubChem CID | 166747587 |
| Molecular Formula | C15H13BrClFN2O2 |
| Molecular Weight | 387.64 g/mol |
| Exact Mass | 385.98 |
| IUPAC Name | 1-(3-bromo-5-fluorophenyl)-3-[5-chloro-2-(2-hydroxyethyl)phenyl]urea |
| SMILES | O=C(Nc1cc(F)cc(Br)c1)Nc1cc(Cl)ccc1CCO |
| InChI | InChI=1S/C15H13BrClFN2O2/c16-10-5-12(18)8-13(6-10)19-15(22)20-14-7-11(17)2-1-9(14)3-4-21/h1-2,5-8,21H,3-4H2,(H2,19,20,22) |
| InChIKey | IUVRUDZDUCZOJT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.64 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |