C16H15ClF2N4O2 — CID 156854312
N-(2-aminoethyl)-4-chloro-2-[(3,5-difluorophenyl)carbamoylamino]benzamide (PubChem CID 156854312) has the molecular formula C16H15ClF2N4O2 and a molecular weight of 368.77 g/mol. Its IUPAC name is N-(2-aminoethyl)-4-chloro-2-[(3,5-difluorophenyl)carbamoylamino]benzamide.
| Compound Name | N-(2-aminoethyl)-4-chloro-2-[(3,5-difluorophenyl)carbamoylamino]benzamide |
|---|---|
| PubChem CID | 156854312 |
| Molecular Formula | C16H15ClF2N4O2 |
| Molecular Weight | 368.77 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | N-(2-aminoethyl)-4-chloro-2-[(3,5-difluorophenyl)carbamoylamino]benzamide |
| SMILES | NCCNC(=O)c1ccc(Cl)cc1NC(=O)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H15ClF2N4O2/c17-9-1-2-13(15(24)21-4-3-20)14(5-9)23-16(25)22-12-7-10(18)6-11(19)8-12/h1-2,5-8H,3-4,20H2,(H,21,24)(H2,22,23,25) |
| InChIKey | PVERTRKCSDJFAT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.77 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |