C16H15ClFN3O3 — CID 156854180
4-chloro-2-[(3-fluorophenyl)carbamoylamino]-N-(2-hydroxyethyl)benzamide (PubChem CID 156854180) has the molecular formula C16H15ClFN3O3 and a molecular weight of 351.77 g/mol. Its IUPAC name is 4-chloro-2-[(3-fluorophenyl)carbamoylamino]-N-(2-hydroxyethyl)benzamide.
| Compound Name | 4-chloro-2-[(3-fluorophenyl)carbamoylamino]-N-(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 156854180 |
| Molecular Formula | C16H15ClFN3O3 |
| Molecular Weight | 351.77 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 4-chloro-2-[(3-fluorophenyl)carbamoylamino]-N-(2-hydroxyethyl)benzamide |
| SMILES | O=C(Nc1cccc(F)c1)Nc1cc(Cl)ccc1C(=O)NCCO |
| InChI | InChI=1S/C16H15ClFN3O3/c17-10-4-5-13(15(23)19-6-7-22)14(8-10)21-16(24)20-12-3-1-2-11(18)9-12/h1-5,8-9,22H,6-7H2,(H,19,23)(H2,20,21,24) |
| InChIKey | CJYDLSBYPHQZDR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.77 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |