C14H11Cl3N2O2 — CID 175721828
1-(3-chloro-5-methoxyphenyl)-3-(3,5-dichlorophenyl)urea (PubChem CID 175721828) has the molecular formula C14H11Cl3N2O2 and a molecular weight of 345.61 g/mol. Its IUPAC name is 1-(3-chloro-5-methoxyphenyl)-3-(3,5-dichlorophenyl)urea.
| Compound Name | 1-(3-chloro-5-methoxyphenyl)-3-(3,5-dichlorophenyl)urea |
|---|---|
| PubChem CID | 175721828 |
| Molecular Formula | C14H11Cl3N2O2 |
| Molecular Weight | 345.61 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | 1-(3-chloro-5-methoxyphenyl)-3-(3,5-dichlorophenyl)urea |
| SMILES | COc1cc(Cl)cc(NC(=O)Nc2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C14H11Cl3N2O2/c1-21-13-6-10(17)5-12(7-13)19-14(20)18-11-3-8(15)2-9(16)4-11/h2-7H,1H3,(H2,18,19,20) |
| InChIKey | ZVBZNTYNMCGZFL-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.61 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |