(3-chloro-5-methoxyphenyl)hydrazine;phosphoric acid

C7H12ClN2O5P — CID 174887306

IUPAC(3-chloro-5-methoxyphenyl)hydrazine;phosphoric acid
SMILESCOc1cc(Cl)cc(NN)c1.O=P(O)(O)O
InChIInChI=1S/C7H9ClN2O.H3O4P/c1-11-7-3-5(8)2-6(4-7)10-9;1-5(2,3)4/h2-4,10H,9H2,1H3;(H3,1,2,3,4)
InChIKeyKJIXEYRAONJCLR-UHFFFAOYSA-N
MW270.61 g/mol
LogP0.71
Rot. Bonds2

About (3-chloro-5-methoxyphenyl)hydrazine;phosphoric acid

(3-chloro-5-methoxyphenyl)hydrazine;phosphoric acid (PubChem CID 174887306) has the molecular formula C7H12ClN2O5P and a molecular weight of 270.61 g/mol. Its IUPAC name is (3-chloro-5-methoxyphenyl)hydrazine;phosphoric acid.

Molecular Properties

Compound Name(3-chloro-5-methoxyphenyl)hydrazine;phosphoric acid
PubChem CID174887306
Molecular FormulaC7H12ClN2O5P
Molecular Weight270.61 g/mol
Exact Mass270.02
IUPAC Name(3-chloro-5-methoxyphenyl)hydrazine;phosphoric acid
SMILESCOc1cc(Cl)cc(NN)c1.O=P(O)(O)O
InChIInChI=1S/C7H9ClN2O.H3O4P/c1-11-7-3-5(8)2-6(4-7)10-9;1-5(2,3)4/h2-4,10H,9H2,1H3;(H3,1,2,3,4)
InChIKeyKJIXEYRAONJCLR-UHFFFAOYSA-N
XLogP0.71
TPSA125.04 Ų
H-Bond Donors5
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.61
LogP ≤ 50.71
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze (3-chloro-5-methoxyphenyl)hydrazine;phosphoric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3-chloro-5-methoxyphenyl)hydrazine;phosphoric acid?
The IUPAC name of (3-chloro-5-methoxyphenyl)hydrazine;phosphoric acid (CID 174887306) is (3-chloro-5-methoxyphenyl)hydrazine;phosphoric acid.
What is the SMILES notation for (3-chloro-5-methoxyphenyl)hydrazine;phosphoric acid?
The canonical SMILES for (3-chloro-5-methoxyphenyl)hydrazine;phosphoric acid is COc1cc(Cl)cc(NN)c1.O=P(O)(O)O.
What is the InChIKey of (3-chloro-5-methoxyphenyl)hydrazine;phosphoric acid?
The InChIKey is KJIXEYRAONJCLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN2O.H3O4P/c1-11-7-3-5(8)2-6(4-7)10-9;1-5(2,3)4/h2-4,10H,9H2,1H3;(H3,1,2,3,4).
What are the key properties of (3-chloro-5-methoxyphenyl)hydrazine;phosphoric acid?
(3-chloro-5-methoxyphenyl)hydrazine;phosphoric acid has a molecular weight of 270.61 g/mol, XLogP of 0.71, 2 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chloro-5-methoxyphenyl)hydrazine;phosphoric acid is sourced from PubChem (CID 174887306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).