C7H12ClN2O5P — CID 174887306
(3-chloro-5-methoxyphenyl)hydrazine;phosphoric acid (PubChem CID 174887306) has the molecular formula C7H12ClN2O5P and a molecular weight of 270.61 g/mol. Its IUPAC name is (3-chloro-5-methoxyphenyl)hydrazine;phosphoric acid.
| Compound Name | (3-chloro-5-methoxyphenyl)hydrazine;phosphoric acid |
|---|---|
| PubChem CID | 174887306 |
| Molecular Formula | C7H12ClN2O5P |
| Molecular Weight | 270.61 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | (3-chloro-5-methoxyphenyl)hydrazine;phosphoric acid |
| SMILES | COc1cc(Cl)cc(NN)c1.O=P(O)(O)O |
| InChI | InChI=1S/C7H9ClN2O.H3O4P/c1-11-7-3-5(8)2-6(4-7)10-9;1-5(2,3)4/h2-4,10H,9H2,1H3;(H3,1,2,3,4) |
| InChIKey | KJIXEYRAONJCLR-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.61 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|