C17H19ClN2O3 — CID 108869537
1-(2-chloro-4,6-dimethylphenyl)-3-(3,5-dimethoxyphenyl)urea (PubChem CID 108869537) has the molecular formula C17H19ClN2O3 and a molecular weight of 334.80 g/mol. Its IUPAC name is 1-(2-chloro-4,6-dimethylphenyl)-3-(3,5-dimethoxyphenyl)urea.
| Compound Name | 1-(2-chloro-4,6-dimethylphenyl)-3-(3,5-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 108869537 |
| Molecular Formula | C17H19ClN2O3 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 1-(2-chloro-4,6-dimethylphenyl)-3-(3,5-dimethoxyphenyl)urea |
| SMILES | COc1cc(NC(=O)Nc2c(C)cc(C)cc2Cl)cc(OC)c1 |
| InChI | InChI=1S/C17H19ClN2O3/c1-10-5-11(2)16(15(18)6-10)20-17(21)19-12-7-13(22-3)9-14(8-12)23-4/h5-9H,1-4H3,(H2,19,20,21) |
| InChIKey | LDHZIKIUGYCGIR-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |