C17H19N3O4 — CID 108869362
N-[4-[(3,5-dimethoxyphenyl)carbamoylamino]phenyl]acetamide (PubChem CID 108869362) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is N-[4-[(3,5-dimethoxyphenyl)carbamoylamino]phenyl]acetamide.
| Compound Name | N-[4-[(3,5-dimethoxyphenyl)carbamoylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 108869362 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | N-[4-[(3,5-dimethoxyphenyl)carbamoylamino]phenyl]acetamide |
| SMILES | COc1cc(NC(=O)Nc2ccc(NC(C)=O)cc2)cc(OC)c1 |
| InChI | InChI=1S/C17H19N3O4/c1-11(21)18-12-4-6-13(7-5-12)19-17(22)20-14-8-15(23-2)10-16(9-14)24-3/h4-10H,1-3H3,(H,18,21)(H2,19,20,22) |
| InChIKey | DVHYHDADAUHJIP-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |